About 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione
3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione (PubChem CID 19064057) has the molecular formula C22H30O3Se
and a molecular weight of 421.44 g/mol. Its IUPAC name is 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione.
Molecular Properties
| Compound Name | 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione |
| PubChem CID | 19064057 |
| Molecular Formula | C22H30O3Se |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione |
| SMILES | CCCCOc1c(C=C2C=C(C(C)(C)C)[Se]C(C(C)(C)C)=C2)c(=O)c1=O |
| InChI | InChI=1S/C22H30O3Se/c1-8-9-10-25-20-15(18(23)19(20)24)11-14-12-16(21(2,3)4)26-17(13-14)22(5,6)7/h11-13H,8-10H2,1-7H3 |
| InChIKey | DNXLMXOELOEHGW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione?
The IUPAC name of 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione (CID 19064057) is 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione.
What is the SMILES notation for 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione?
The canonical SMILES for 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione is CCCCOc1c(C=C2C=C(C(C)(C)C)[Se]C(C(C)(C)C)=C2)c(=O)c1=O.
What is the InChIKey of 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione?
The InChIKey is DNXLMXOELOEHGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O3Se/c1-8-9-10-25-20-15(18(23)19(20)24)11-14-12-16(21(2,3)4)26-17(13-14)22(5,6)7/h11-13H,8-10H2,1-7H3.
What are the key properties of 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione?
3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione has a molecular weight of 421.44 g/mol, XLogP of 4.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-4-[(2,6-ditert-butylselenopyran-4-ylidene)methyl]cyclobut-3-ene-1,2-dione is sourced from PubChem (CID 19064057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).