About N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione (PubChem CID 19064334) has the molecular formula C10H23N5O2
and a molecular weight of 245.33 g/mol. Its IUPAC name is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione |
| PubChem CID | 19064334 |
| Molecular Formula | C10H23N5O2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione |
| SMILES | NCCNCCNCCN.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C6H18N4.C4H5NO2/c7-1-3-9-5-6-10-4-2-8;6-3-1-2-4(7)5-3/h9-10H,1-8H2;1-2H2,(H,5,6,7) |
| InChIKey | MDHGUFGLYYOUSW-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione?
The IUPAC name of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione (CID 19064334) is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione.
What is the SMILES notation for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione?
The canonical SMILES for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione is NCCNCCNCCN.O=C1CCC(=O)N1.
What is the InChIKey of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione?
The InChIKey is MDHGUFGLYYOUSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N4.C4H5NO2/c7-1-3-9-5-6-10-4-2-8;6-3-1-2-4(7)5-3/h9-10H,1-8H2;1-2H2,(H,5,6,7).
What are the key properties of N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione?
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione has a molecular weight of 245.33 g/mol, XLogP of -2.49, 7 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;pyrrolidine-2,5-dione is sourced from PubChem (CID 19064334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).