C23H25ClFN3O3 — CID 19064934
7-fluoro-3-[2-(6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl)ethyl]-1H-quinazoline-2,4-dione;hydrochloride (PubChem CID 19064934) has the molecular formula C23H25ClFN3O3 and a molecular weight of 445.92 g/mol. Its IUPAC name is 7-fluoro-3-[2-(6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl)ethyl]-1H-quinazoline-2,4-dione;hydrochloride.
| Compound Name | 7-fluoro-3-[2-(6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl)ethyl]-1H-quinazoline-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 19064934 |
| Molecular Formula | C23H25ClFN3O3 |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 7-fluoro-3-[2-(6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl)ethyl]-1H-quinazoline-2,4-dione;hydrochloride |
| SMILES | COc1cccc2c1CCC1CNC(CCn3c(=O)[nH]c4cc(F)ccc4c3=O)C21.Cl |
| InChI | InChI=1S/C23H24FN3O3.ClH/c1-30-20-4-2-3-16-15(20)7-5-13-12-25-18(21(13)16)9-10-27-22(28)17-8-6-14(24)11-19(17)26-23(27)29;/h2-4,6,8,11,13,18,21,25H,5,7,9-10,12H2,1H3,(H,26,29);1H |
| InChIKey | BONXHFQHKQONIR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |