C22H18F6N2O4 — CID 19065118
1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]piperazine-2,3-dione (PubChem CID 19065118) has the molecular formula C22H18F6N2O4 and a molecular weight of 488.38 g/mol. Its IUPAC name is 1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]piperazine-2,3-dione.
| Compound Name | 1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 19065118 |
| Molecular Formula | C22H18F6N2O4 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 1-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]piperazine-2,3-dione |
| SMILES | CC(N1CCN(c2ccc(OC(F)(F)C(F)F)cc2)C(=O)C1=O)C1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C22H18F6N2O4/c1-12(21(11-33-21)16-7-2-13(23)10-17(16)24)29-8-9-30(19(32)18(29)31)14-3-5-15(6-4-14)34-22(27,28)20(25)26/h2-7,10,12,20H,8-9,11H2,1H3 |
| InChIKey | DZRRCYAOFDHYQG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|