C21H18N4O3 — CID 19066045
N-(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-14-yl)-2-phenylacetamide;hydrate (PubChem CID 19066045) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-14-yl)-2-phenylacetamide;hydrate.
| Compound Name | N-(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-14-yl)-2-phenylacetamide;hydrate |
|---|---|
| PubChem CID | 19066045 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-14-yl)-2-phenylacetamide;hydrate |
| SMILES | O.O=C(Cc1ccccc1)Nc1cccc2c1Cc1c-2[nH]c(=O)c2nccn12 |
| InChI | InChI=1S/C21H16N4O2.H2O/c26-18(11-13-5-2-1-3-6-13)23-16-8-4-7-14-15(16)12-17-19(14)24-21(27)20-22-9-10-25(17)20;/h1-10H,11-12H2,(H,23,26)(H,24,27);1H2 |
| InChIKey | POCWSJUKTSJXFC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |