C14H11N5O2 — CID 19066056
(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-13-yl)urea (PubChem CID 19066056) has the molecular formula C14H11N5O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is (7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-13-yl)urea.
| Compound Name | (7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-13-yl)urea |
|---|---|
| PubChem CID | 19066056 |
| Molecular Formula | C14H11N5O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-13-yl)urea |
| SMILES | NC(=O)Nc1ccc2c(c1)Cc1c-2[nH]c(=O)c2nccn12 |
| InChI | InChI=1S/C14H11N5O2/c15-14(21)17-8-1-2-9-7(5-8)6-10-11(9)18-13(20)12-16-3-4-19(10)12/h1-5H,6H2,(H,18,20)(H3,15,17,21) |
| InChIKey | BKERCVHGZKGPHL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |