About 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one
3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one (PubChem CID 19066385) has the molecular formula C12H12F3NO
and a molecular weight of 243.23 g/mol. Its IUPAC name is 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one.
Molecular Properties
| Compound Name | 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one |
| PubChem CID | 19066385 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one |
| SMILES | CC1(C)CNc2cc(C(F)(F)F)ccc2C1=O |
| InChI | InChI=1S/C12H12F3NO/c1-11(2)6-16-9-5-7(12(13,14)15)3-4-8(9)10(11)17/h3-5,16H,6H2,1-2H3 |
| InChIKey | PMUJSNOUVZHFCM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one?
The IUPAC name of 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one (CID 19066385) is 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one.
What is the SMILES notation for 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one?
The canonical SMILES for 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one is CC1(C)CNc2cc(C(F)(F)F)ccc2C1=O.
What is the InChIKey of 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one?
The InChIKey is PMUJSNOUVZHFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3NO/c1-11(2)6-16-9-5-7(12(13,14)15)3-4-8(9)10(11)17/h3-5,16H,6H2,1-2H3.
What are the key properties of 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one?
3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one has a molecular weight of 243.23 g/mol, XLogP of 3.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-7-(trifluoromethyl)-1,2-dihydroquinolin-4-one is sourced from PubChem (CID 19066385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).