C21H22ClN3O — CID 19066538
1-(5-benzyl-1,2,3,6-tetrahydropyridin-6-yl)-3-(3-chlorophenyl)imidazolidin-2-one (PubChem CID 19066538) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is 1-(5-benzyl-1,2,3,6-tetrahydropyridin-6-yl)-3-(3-chlorophenyl)imidazolidin-2-one.
| Compound Name | 1-(5-benzyl-1,2,3,6-tetrahydropyridin-6-yl)-3-(3-chlorophenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 19066538 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-(5-benzyl-1,2,3,6-tetrahydropyridin-6-yl)-3-(3-chlorophenyl)imidazolidin-2-one |
| SMILES | O=C1N(c2cccc(Cl)c2)CCN1C1NCCC=C1Cc1ccccc1 |
| InChI | InChI=1S/C21H22ClN3O/c22-18-9-4-10-19(15-18)24-12-13-25(21(24)26)20-17(8-5-11-23-20)14-16-6-2-1-3-7-16/h1-4,6-10,15,20,23H,5,11-14H2 |
| InChIKey | CXUDZQOAWCGOCM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|