C9H9IN2O — CID 19067074
7-iodo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one (PubChem CID 19067074) has the molecular formula C9H9IN2O and a molecular weight of 288.09 g/mol. Its IUPAC name is 7-iodo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one.
| Compound Name | 7-iodo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one |
|---|---|
| PubChem CID | 19067074 |
| Molecular Formula | C9H9IN2O |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 7-iodo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one |
| SMILES | O=C1Nc2ncccc2CCC1I |
| InChI | InChI=1S/C9H9IN2O/c10-7-4-3-6-2-1-5-11-8(6)12-9(7)13/h1-2,5,7H,3-4H2,(H,11,12,13) |
| InChIKey | HOOJIZFZTSLFGO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|