C7H6F8 — CID 19067254
(Z)-1,1,1,3,4,5,5,5-octafluoro-2,4-dimethylpent-2-ene (PubChem CID 19067254) has the molecular formula C7H6F8 and a molecular weight of 242.11 g/mol. Its IUPAC name is (Z)-1,1,1,3,4,5,5,5-octafluoro-2,4-dimethylpent-2-ene.
| Compound Name | (Z)-1,1,1,3,4,5,5,5-octafluoro-2,4-dimethylpent-2-ene |
|---|---|
| PubChem CID | 19067254 |
| Molecular Formula | C7H6F8 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | (Z)-1,1,1,3,4,5,5,5-octafluoro-2,4-dimethylpent-2-ene |
| SMILES | C/C(=C(/F)C(C)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F8/c1-3(6(10,11)12)4(8)5(2,9)7(13,14)15/h1-2H3/b4-3- |
| InChIKey | DYSKQDKPJGUVJB-ARJAWSKDSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |