C9H10F8O — CID 19067257
2-fluoro-3-propan-2-yl-3-(1,1,1,2-tetrafluoropropan-2-yl)-2-(trifluoromethyl)oxirane (PubChem CID 19067257) has the molecular formula C9H10F8O and a molecular weight of 286.16 g/mol. Its IUPAC name is 2-fluoro-3-propan-2-yl-3-(1,1,1,2-tetrafluoropropan-2-yl)-2-(trifluoromethyl)oxirane.
| Compound Name | 2-fluoro-3-propan-2-yl-3-(1,1,1,2-tetrafluoropropan-2-yl)-2-(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 19067257 |
| Molecular Formula | C9H10F8O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-fluoro-3-propan-2-yl-3-(1,1,1,2-tetrafluoropropan-2-yl)-2-(trifluoromethyl)oxirane |
| SMILES | CC(C)C1(C(C)(F)C(F)(F)F)OC1(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F8O/c1-4(2)6(5(3,10)8(12,13)14)7(11,18-6)9(15,16)17/h4H,1-3H3 |
| InChIKey | HIICUADOOFKYRO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|