C6H3F9O — CID 19067258
2-fluoro-3-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)oxirane (PubChem CID 19067258) has the molecular formula C6H3F9O and a molecular weight of 262.07 g/mol. Its IUPAC name is 2-fluoro-3-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)oxirane.
| Compound Name | 2-fluoro-3-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 19067258 |
| Molecular Formula | C6H3F9O |
| Molecular Weight | 262.07 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-fluoro-3-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)oxirane |
| SMILES | CC1(C(F)(F)F)OC1(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H3F9O/c1-2(5(10,11)12)4(9,16-2)3(7,8)6(13,14)15/h1H3 |
| InChIKey | HTBODCHTRKAJSX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.07 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|