About 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane
2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane (PubChem CID 19067267) has the molecular formula C16H38OSi2
and a molecular weight of 302.65 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane |
| PubChem CID | 19067267 |
| Molecular Formula | C16H38OSi2 |
| Molecular Weight | 302.65 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane |
| SMILES | CC(C)C(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C16H38OSi2/c1-13(2)15(5,6)18(9,10)17-19(11,12)16(7,8)14(3)4/h13-14H,1-12H3 |
| InChIKey | RQQWVNXRKRSUCC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane?
The IUPAC name of 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane (CID 19067267) is 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane.
What is the SMILES notation for 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane?
The canonical SMILES for 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane is CC(C)C(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C(C)C.
What is the InChIKey of 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane?
The InChIKey is RQQWVNXRKRSUCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H38OSi2/c1-13(2)15(5,6)18(9,10)17-19(11,12)16(7,8)14(3)4/h13-14H,1-12H3.
What are the key properties of 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane?
2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane has a molecular weight of 302.65 g/mol, XLogP of 6.29, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutan-2-yl-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-dimethylsilane is sourced from PubChem (CID 19067267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).