C8H7N5O6 — CID 19067462
5-[(2,4,6-trioxo-1,3-diazinan-5-yl)amino]-1,3-diazinane-2,4,6-trione (PubChem CID 19067462) has the molecular formula C8H7N5O6 and a molecular weight of 269.17 g/mol. Its IUPAC name is 5-[(2,4,6-trioxo-1,3-diazinan-5-yl)amino]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2,4,6-trioxo-1,3-diazinan-5-yl)amino]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 19067462 |
| Molecular Formula | C8H7N5O6 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 5-[(2,4,6-trioxo-1,3-diazinan-5-yl)amino]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(NC2C(=O)NC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C8H7N5O6/c14-3-1(4(15)11-7(18)10-3)9-2-5(16)12-8(19)13-6(2)17/h1-2,9H,(H2,10,11,14,15,18)(H2,12,13,16,17,19) |
| InChIKey | YYNMZSWLLNOEOS-UHFFFAOYSA-N |
| XLogP | -3.95 |
| TPSA | 162.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|