About trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide
trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide (PubChem CID 19067543) has the molecular formula C11H27NO
and a molecular weight of 189.34 g/mol. Its IUPAC name is trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide.
Molecular Properties
| Compound Name | trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide |
| PubChem CID | 19067543 |
| Molecular Formula | C11H27NO |
| Molecular Weight | 189.34 g/mol |
| Exact Mass | 189.21 |
| IUPAC Name | trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide |
| SMILES | CC(C)(C)CC(C)(C)[N+](C)(C)C.[OH-] |
| InChI | InChI=1S/C11H26N.H2O/c1-10(2,3)9-11(4,5)12(6,7)8;/h9H2,1-8H3;1H2/q+1;/p-1 |
| InChIKey | MHEGQXBHZGZQDX-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide?
The IUPAC name of trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide (CID 19067543) is trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide.
What is the SMILES notation for trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide?
The canonical SMILES for trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide is CC(C)(C)CC(C)(C)[N+](C)(C)C.[OH-].
What is the InChIKey of trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide?
The InChIKey is MHEGQXBHZGZQDX-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H26N.H2O/c1-10(2,3)9-11(4,5)12(6,7)8;/h9H2,1-8H3;1H2/q+1;/p-1.
What are the key properties of trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide?
trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide has a molecular weight of 189.34 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(2,4,4-trimethylpentan-2-yl)azanium hydroxide is sourced from PubChem (CID 19067543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).