About 2,4-dimethyl-5H-pyrimido[4,5-b]indole
2,4-dimethyl-5H-pyrimido[4,5-b]indole (PubChem CID 19067856) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2,4-dimethyl-5H-pyrimido[4,5-b]indole.
Molecular Properties
| Compound Name | 2,4-dimethyl-5H-pyrimido[4,5-b]indole |
| PubChem CID | 19067856 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2,4-dimethyl-5H-pyrimido[4,5-b]indole |
| SMILES | Cc1nc(C)c2c(n1)=NC1=CC=CCC=21 |
| InChI | InChI=1S/C12H11N3/c1-7-11-9-5-3-4-6-10(9)15-12(11)14-8(2)13-7/h3-4,6H,5H2,1-2H3 |
| InChIKey | DSIGSUTWMZBWBT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-5H-pyrimido[4,5-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-5H-pyrimido[4,5-b]indole?
The IUPAC name of 2,4-dimethyl-5H-pyrimido[4,5-b]indole (CID 19067856) is 2,4-dimethyl-5H-pyrimido[4,5-b]indole.
What is the SMILES notation for 2,4-dimethyl-5H-pyrimido[4,5-b]indole?
The canonical SMILES for 2,4-dimethyl-5H-pyrimido[4,5-b]indole is Cc1nc(C)c2c(n1)=NC1=CC=CCC=21.
What is the InChIKey of 2,4-dimethyl-5H-pyrimido[4,5-b]indole?
The InChIKey is DSIGSUTWMZBWBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3/c1-7-11-9-5-3-4-6-10(9)15-12(11)14-8(2)13-7/h3-4,6H,5H2,1-2H3.
What are the key properties of 2,4-dimethyl-5H-pyrimido[4,5-b]indole?
2,4-dimethyl-5H-pyrimido[4,5-b]indole has a molecular weight of 197.24 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-5H-pyrimido[4,5-b]indole is sourced from PubChem (CID 19067856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).