About 5-cyclopropyl-4,5-dihydro-1H-pyrazole
5-cyclopropyl-4,5-dihydro-1H-pyrazole (PubChem CID 19068006) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 5-cyclopropyl-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 5-cyclopropyl-4,5-dihydro-1H-pyrazole |
| PubChem CID | 19068006 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 5-cyclopropyl-4,5-dihydro-1H-pyrazole |
| SMILES | C1=NNC(C2CC2)C1 |
| InChI | InChI=1S/C6H10N2/c1-2-5(1)6-3-4-7-8-6/h4-6,8H,1-3H2 |
| InChIKey | UMMVEMDQBNKDSO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclopropyl-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-4,5-dihydro-1H-pyrazole?
The IUPAC name of 5-cyclopropyl-4,5-dihydro-1H-pyrazole (CID 19068006) is 5-cyclopropyl-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for 5-cyclopropyl-4,5-dihydro-1H-pyrazole?
The canonical SMILES for 5-cyclopropyl-4,5-dihydro-1H-pyrazole is C1=NNC(C2CC2)C1.
What is the InChIKey of 5-cyclopropyl-4,5-dihydro-1H-pyrazole?
The InChIKey is UMMVEMDQBNKDSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-2-5(1)6-3-4-7-8-6/h4-6,8H,1-3H2.
What are the key properties of 5-cyclopropyl-4,5-dihydro-1H-pyrazole?
5-cyclopropyl-4,5-dihydro-1H-pyrazole has a molecular weight of 110.16 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 19068006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).