About 4-cyclohexyl-2,3-dihydro-1H-pyrrole
4-cyclohexyl-2,3-dihydro-1H-pyrrole (PubChem CID 19068034) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 4-cyclohexyl-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 4-cyclohexyl-2,3-dihydro-1H-pyrrole |
| PubChem CID | 19068034 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 4-cyclohexyl-2,3-dihydro-1H-pyrrole |
| SMILES | C1=C(C2CCCCC2)CCN1 |
| InChI | InChI=1S/C10H17N/c1-2-4-9(5-3-1)10-6-7-11-8-10/h8-9,11H,1-7H2 |
| InChIKey | XELVRZIIFWVIMA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexyl-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-2,3-dihydro-1H-pyrrole?
The IUPAC name of 4-cyclohexyl-2,3-dihydro-1H-pyrrole (CID 19068034) is 4-cyclohexyl-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 4-cyclohexyl-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 4-cyclohexyl-2,3-dihydro-1H-pyrrole is C1=C(C2CCCCC2)CCN1.
What is the InChIKey of 4-cyclohexyl-2,3-dihydro-1H-pyrrole?
The InChIKey is XELVRZIIFWVIMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-2-4-9(5-3-1)10-6-7-11-8-10/h8-9,11H,1-7H2.
What are the key properties of 4-cyclohexyl-2,3-dihydro-1H-pyrrole?
4-cyclohexyl-2,3-dihydro-1H-pyrrole has a molecular weight of 151.25 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 19068034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).