C22H29NO2 — CID 19068047
1-(cyclohexylmethyl)-6-prop-2-enoxy-7-prop-2-enyl-3,4-dihydroquinolin-2-one (PubChem CID 19068047) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-6-prop-2-enoxy-7-prop-2-enyl-3,4-dihydroquinolin-2-one.
| Compound Name | 1-(cyclohexylmethyl)-6-prop-2-enoxy-7-prop-2-enyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 19068047 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 1-(cyclohexylmethyl)-6-prop-2-enoxy-7-prop-2-enyl-3,4-dihydroquinolin-2-one |
| SMILES | C=CCOc1cc2c(cc1CC=C)N(CC1CCCCC1)C(=O)CC2 |
| InChI | InChI=1S/C22H29NO2/c1-3-8-19-14-20-18(15-21(19)25-13-4-2)11-12-22(24)23(20)16-17-9-6-5-7-10-17/h3-4,14-15,17H,1-2,5-13,16H2 |
| InChIKey | IOOAWYHJNKLRBX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|