C5HCl4N3O4 — CID 19068131
2,3,5,6-tetrachloro-1,4-dinitro-2H-pyridine (PubChem CID 19068131) has the molecular formula C5HCl4N3O4 and a molecular weight of 308.89 g/mol. Its IUPAC name is 2,3,5,6-tetrachloro-1,4-dinitro-2H-pyridine.
| Compound Name | 2,3,5,6-tetrachloro-1,4-dinitro-2H-pyridine |
|---|---|
| PubChem CID | 19068131 |
| Molecular Formula | C5HCl4N3O4 |
| Molecular Weight | 308.89 g/mol |
| Exact Mass | 306.87 |
| IUPAC Name | 2,3,5,6-tetrachloro-1,4-dinitro-2H-pyridine |
| SMILES | O=[N+]([O-])C1=C(Cl)C(Cl)N([N+](=O)[O-])C(Cl)=C1Cl |
| InChI | InChI=1S/C5HCl4N3O4/c6-1-3(11(13)14)2(7)5(9)10(4(1)8)12(15)16/h4H |
| InChIKey | USCOAJKQRPEANI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.89 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|