About 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate
1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate (PubChem CID 19068327) has the molecular formula C12H22O4S
and a molecular weight of 262.37 g/mol. Its IUPAC name is 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate |
| PubChem CID | 19068327 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate |
| SMILES | COC(=O)CCCCCCCC(=O)OCCS |
| InChI | InChI=1S/C12H22O4S/c1-15-11(13)7-5-3-2-4-6-8-12(14)16-9-10-17/h17H,2-10H2,1H3 |
| InChIKey | LLCBOXDAOOTFLU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate?
The IUPAC name of 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate (CID 19068327) is 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate.
What is the SMILES notation for 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate?
The canonical SMILES for 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate is COC(=O)CCCCCCCC(=O)OCCS.
What is the InChIKey of 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate?
The InChIKey is LLCBOXDAOOTFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4S/c1-15-11(13)7-5-3-2-4-6-8-12(14)16-9-10-17/h17H,2-10H2,1H3.
What are the key properties of 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate?
1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate has a molecular weight of 262.37 g/mol, XLogP of 2.36, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 9-O-(2-sulfanylethyl) nonanedioate is sourced from PubChem (CID 19068327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).