About 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene]
3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene] (PubChem CID 19068568) has the molecular formula C18H16N2O3
and a molecular weight of 308.34 g/mol. Its IUPAC name is 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene].
Molecular Properties
| Compound Name | 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene] |
| PubChem CID | 19068568 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene] |
| SMILES | CC1(C)c2ccccc2NC12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C18H16N2O3/c1-17(2)14-5-3-4-6-15(14)19-18(17)10-9-12-11-13(20(21)22)7-8-16(12)23-18/h3-11,19H,1-2H3 |
| InChIKey | RSZVWFWUYVHSLG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene]?
The IUPAC name of 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene] (CID 19068568) is 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene].
What is the SMILES notation for 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene]?
The canonical SMILES for 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene] is CC1(C)c2ccccc2NC12C=Cc1cc([N+](=O)[O-])ccc1O2.
What is the InChIKey of 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene]?
The InChIKey is RSZVWFWUYVHSLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O3/c1-17(2)14-5-3-4-6-15(14)19-18(17)10-9-12-11-13(20(21)22)7-8-16(12)23-18/h3-11,19H,1-2H3.
What are the key properties of 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene]?
3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene] has a molecular weight of 308.34 g/mol, XLogP of 4.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-6'-nitrospiro[1H-indole-2,2'-chromene] is sourced from PubChem (CID 19068568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).