C11H15N — CID 19069129
1,2,2a,3,5a,6,8a,9-octahydrobenzo[cd]indole (PubChem CID 19069129) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 1,2,2a,3,5a,6,8a,9-octahydrobenzo[cd]indole.
| Compound Name | 1,2,2a,3,5a,6,8a,9-octahydrobenzo[cd]indole |
|---|---|
| PubChem CID | 19069129 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1,2,2a,3,5a,6,8a,9-octahydrobenzo[cd]indole |
| SMILES | C1=CC2NCC3CC=CC(C1)C32 |
| InChI | InChI=1S/C11H15N/c1-3-8-4-2-6-10-11(8)9(5-1)7-12-10/h1-3,6,8-12H,4-5,7H2 |
| InChIKey | JYBZQHZFGRYPMD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|