C9H16N2 — CID 19069753
N-methyl-2,3,3a,4,5,6-hexahydro-1H-isoindol-4-amine (PubChem CID 19069753) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N-methyl-2,3,3a,4,5,6-hexahydro-1H-isoindol-4-amine.
| Compound Name | N-methyl-2,3,3a,4,5,6-hexahydro-1H-isoindol-4-amine |
|---|---|
| PubChem CID | 19069753 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N-methyl-2,3,3a,4,5,6-hexahydro-1H-isoindol-4-amine |
| SMILES | CNC1CCC=C2CNCC21 |
| InChI | InChI=1S/C9H16N2/c1-10-9-4-2-3-7-5-11-6-8(7)9/h3,8-11H,2,4-6H2,1H3 |
| InChIKey | HDIXWPARKRUKGZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|