C16H19NO2 — CID 19069761
2-benzyl-1,3,3a,4,5,6-hexahydroisoindole-5-carboxylic acid (PubChem CID 19069761) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-benzyl-1,3,3a,4,5,6-hexahydroisoindole-5-carboxylic acid.
| Compound Name | 2-benzyl-1,3,3a,4,5,6-hexahydroisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 19069761 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-benzyl-1,3,3a,4,5,6-hexahydroisoindole-5-carboxylic acid |
| SMILES | O=C(O)C1CC=C2CN(Cc3ccccc3)CC2C1 |
| InChI | InChI=1S/C16H19NO2/c18-16(19)13-6-7-14-10-17(11-15(14)8-13)9-12-4-2-1-3-5-12/h1-5,7,13,15H,6,8-11H2,(H,18,19) |
| InChIKey | GZLYNZHMGUKPRE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|