methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate

C8H11NO2 — CID 19069780

IUPACmethyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate
SMILESC=CC1=CCN(C(=O)OC)C1
InChIInChI=1S/C8H11NO2/c1-3-7-4-5-9(6-7)8(10)11-2/h3-4H,1,5-6H2,2H3
InChIKeyHTIVHNUULGKXMR-UHFFFAOYSA-N
MW153.18 g/mol
LogP1.18
Rot. Bonds1

About methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate

methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate (PubChem CID 19069780) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate.

Molecular Properties

Compound Namemethyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate
PubChem CID19069780
Molecular FormulaC8H11NO2
Molecular Weight153.18 g/mol
Exact Mass153.08
IUPAC Namemethyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate
SMILESC=CC1=CCN(C(=O)OC)C1
InChIInChI=1S/C8H11NO2/c1-3-7-4-5-9(6-7)8(10)11-2/h3-4H,1,5-6H2,2H3
InChIKeyHTIVHNUULGKXMR-UHFFFAOYSA-N
XLogP1.18
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.18
LogP ≤ 51.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate?
The IUPAC name of methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate (CID 19069780) is methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate.
What is the SMILES notation for methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate?
The canonical SMILES for methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate is C=CC1=CCN(C(=O)OC)C1.
What is the InChIKey of methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate?
The InChIKey is HTIVHNUULGKXMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-3-7-4-5-9(6-7)8(10)11-2/h3-4H,1,5-6H2,2H3.
What are the key properties of methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate?
methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate has a molecular weight of 153.18 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-ethenyl-2,5-dihydropyrrole-1-carboxylate is sourced from PubChem (CID 19069780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).