About 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione
5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione (PubChem CID 19071298) has the molecular formula C18H29N3O2
and a molecular weight of 319.45 g/mol. Its IUPAC name is 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione |
| PubChem CID | 19071298 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione |
| SMILES | Nc1cn(CC2CCCCC2)c(=O)n(CC2CCCCC2)c1=O |
| InChI | InChI=1S/C18H29N3O2/c19-16-13-20(11-14-7-3-1-4-8-14)18(23)21(17(16)22)12-15-9-5-2-6-10-15/h13-15H,1-12,19H2 |
| InChIKey | LTKDIHPWZQIDRK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione?
The IUPAC name of 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione (CID 19071298) is 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione?
The canonical SMILES for 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione is Nc1cn(CC2CCCCC2)c(=O)n(CC2CCCCC2)c1=O.
What is the InChIKey of 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione?
The InChIKey is LTKDIHPWZQIDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O2/c19-16-13-20(11-14-7-3-1-4-8-14)18(23)21(17(16)22)12-15-9-5-2-6-10-15/h13-15H,1-12,19H2.
What are the key properties of 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione?
5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione has a molecular weight of 319.45 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3-bis(cyclohexylmethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 19071298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).