C30H36N2O5 — CID 19071930
[4a-(3-acetyloxyphenyl)-6-[benzoyl(methyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate (PubChem CID 19071930) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is [4a-(3-acetyloxyphenyl)-6-[benzoyl(methyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate.
| Compound Name | [4a-(3-acetyloxyphenyl)-6-[benzoyl(methyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
|---|---|
| PubChem CID | 19071930 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | [4a-(3-acetyloxyphenyl)-6-[benzoyl(methyl)amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-8-yl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(OC(C)=O)c3)CC(N(C)C(=O)c3ccccc3)CC(OC(C)=O)C2C1 |
| InChI | InChI=1S/C30H36N2O5/c1-5-15-32-16-14-30(24-12-9-13-26(17-24)36-21(2)33)19-25(18-28(27(30)20-32)37-22(3)34)31(4)29(35)23-10-7-6-8-11-23/h5-13,17,25,27-28H,1,14-16,18-20H2,2-4H3 |
| InChIKey | RYXSJVOKBFMRQE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|