C13H13N3O6S — CID 19072285
2-methyl-5-nitro-8-oxo-1,3,4,7-tetrahydro-2,7-phenanthroline-9-sulfonic acid (PubChem CID 19072285) has the molecular formula C13H13N3O6S and a molecular weight of 339.33 g/mol. Its IUPAC name is 2-methyl-5-nitro-8-oxo-1,3,4,7-tetrahydro-2,7-phenanthroline-9-sulfonic acid.
| Compound Name | 2-methyl-5-nitro-8-oxo-1,3,4,7-tetrahydro-2,7-phenanthroline-9-sulfonic acid |
|---|---|
| PubChem CID | 19072285 |
| Molecular Formula | C13H13N3O6S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-methyl-5-nitro-8-oxo-1,3,4,7-tetrahydro-2,7-phenanthroline-9-sulfonic acid |
| SMILES | CN1CCc2c([N+](=O)[O-])cc3[nH]c(=O)c(S(=O)(=O)O)cc3c2C1 |
| InChI | InChI=1S/C13H13N3O6S/c1-15-3-2-7-9(6-15)8-4-12(23(20,21)22)13(17)14-10(8)5-11(7)16(18)19/h4-5H,2-3,6H2,1H3,(H,14,17)(H,20,21,22) |
| InChIKey | OMJFLEVRNRIAOL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 133.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|