About N-benzyl-1,2-dihydropyridin-2-amine
N-benzyl-1,2-dihydropyridin-2-amine (PubChem CID 19072346) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is N-benzyl-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | N-benzyl-1,2-dihydropyridin-2-amine |
| PubChem CID | 19072346 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | N-benzyl-1,2-dihydropyridin-2-amine |
| SMILES | C1=CNC(NCc2ccccc2)C=C1 |
| InChI | InChI=1S/C12H14N2/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13-12/h1-9,12-14H,10H2 |
| InChIKey | LNURMDMKVBPZSX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1,2-dihydropyridin-2-amine?
The IUPAC name of N-benzyl-1,2-dihydropyridin-2-amine (CID 19072346) is N-benzyl-1,2-dihydropyridin-2-amine.
What is the SMILES notation for N-benzyl-1,2-dihydropyridin-2-amine?
The canonical SMILES for N-benzyl-1,2-dihydropyridin-2-amine is C1=CNC(NCc2ccccc2)C=C1.
What is the InChIKey of N-benzyl-1,2-dihydropyridin-2-amine?
The InChIKey is LNURMDMKVBPZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13-12/h1-9,12-14H,10H2.
What are the key properties of N-benzyl-1,2-dihydropyridin-2-amine?
N-benzyl-1,2-dihydropyridin-2-amine has a molecular weight of 186.26 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 19072346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).