C22H15Cl3N4O3 — CID 19072913
2,6-dichloro-N-[[4-[(6-chloro-5-cyano-2-pyridinyl)oxy]-3,5-dimethylphenyl]carbamoyl]benzamide (PubChem CID 19072913) has the molecular formula C22H15Cl3N4O3 and a molecular weight of 489.75 g/mol. Its IUPAC name is 2,6-dichloro-N-[[4-[(6-chloro-5-cyano-2-pyridinyl)oxy]-3,5-dimethylphenyl]carbamoyl]benzamide.
| Compound Name | 2,6-dichloro-N-[[4-[(6-chloro-5-cyano-2-pyridinyl)oxy]-3,5-dimethylphenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 19072913 |
| Molecular Formula | C22H15Cl3N4O3 |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | 2,6-dichloro-N-[[4-[(6-chloro-5-cyano-2-pyridinyl)oxy]-3,5-dimethylphenyl]carbamoyl]benzamide |
| SMILES | Cc1cc(NC(=O)NC(=O)c2c(Cl)cccc2Cl)cc(C)c1Oc1ccc(C#N)c(Cl)n1 |
| InChI | InChI=1S/C22H15Cl3N4O3/c1-11-8-14(27-22(31)29-21(30)18-15(23)4-3-5-16(18)24)9-12(2)19(11)32-17-7-6-13(10-26)20(25)28-17/h3-9H,1-2H3,(H2,27,29,30,31) |
| InChIKey | SZKKRFKTRAQBAG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|