About 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid
4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid (PubChem CID 19072929) has the molecular formula C16H20N4O5S
and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid.
Molecular Properties
| Compound Name | 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid |
| PubChem CID | 19072929 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid |
| SMILES | O=S(=O)(O)CCO.[H]/N=C(\N)c1ccc(Oc2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C14H14N4O.C2H6O4S/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18;3-1-2-7(4,5)6/h1-8H,(H3,15,16)(H3,17,18);3H,1-2H2,(H,4,5,6) |
| InChIKey | JCYHBAYBZRYGPC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 183.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid?
The IUPAC name of 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid (CID 19072929) is 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid.
What is the SMILES notation for 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid?
The canonical SMILES for 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid is O=S(=O)(O)CCO.[H]/N=C(\N)c1ccc(Oc2ccc(/C(N)=N/[H])cc2)cc1.
What is the InChIKey of 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid?
The InChIKey is JCYHBAYBZRYGPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O.C2H6O4S/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18;3-1-2-7(4,5)6/h1-8H,(H3,15,16)(H3,17,18);3H,1-2H2,(H,4,5,6).
What are the key properties of 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid?
4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid has a molecular weight of 380.43 g/mol, XLogP of 0.91, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-carbamimidoylphenoxy)benzenecarboximidamide;2-hydroxyethanesulfonic acid is sourced from PubChem (CID 19072929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).