About (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate
(Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate (PubChem CID 19073318) has the molecular formula C18H22O6-2
and a molecular weight of 334.37 g/mol. Its IUPAC name is (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate.
Molecular Properties
| Compound Name | (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate |
| PubChem CID | 19073318 |
| Molecular Formula | C18H22O6-2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate |
| SMILES | O=C([O-])/C(CC1CCC2OC2C1)=C(/CC1CCC2OC2C1)C(=O)[O-] |
| InChI | InChI=1S/C18H24O6/c19-17(20)11(5-9-1-3-13-15(7-9)23-13)12(18(21)22)6-10-2-4-14-16(8-10)24-14/h9-10,13-16H,1-8H2,(H,19,20)(H,21,22)/p-2/b12-11- |
| InChIKey | CTQZVZVWYONGBE-QXMHVHEDSA-L |
| XLogP | -0.30 |
| TPSA | 105.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate?
The IUPAC name of (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate (CID 19073318) is (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate.
What is the SMILES notation for (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate?
The canonical SMILES for (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate is O=C([O-])/C(CC1CCC2OC2C1)=C(/CC1CCC2OC2C1)C(=O)[O-].
What is the InChIKey of (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate?
The InChIKey is CTQZVZVWYONGBE-QXMHVHEDSA-L. The full InChI is InChI=1S/C18H24O6/c19-17(20)11(5-9-1-3-13-15(7-9)23-13)12(18(21)22)6-10-2-4-14-16(8-10)24-14/h9-10,13-16H,1-8H2,(H,19,20)(H,21,22)/p-2/b12-11-.
What are the key properties of (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate?
(Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate has a molecular weight of 334.37 g/mol, XLogP of -0.30, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)but-2-enedioate is sourced from PubChem (CID 19073318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).