About sulfonylurea;1,3,5-triazine
sulfonylurea;1,3,5-triazine (PubChem CID 19074086) has the molecular formula C4H5N5O3S
and a molecular weight of 203.18 g/mol. Its IUPAC name is sulfonylurea;1,3,5-triazine.
Molecular Properties
| Compound Name | sulfonylurea;1,3,5-triazine |
| PubChem CID | 19074086 |
| Molecular Formula | C4H5N5O3S |
| Molecular Weight | 203.18 g/mol |
| Exact Mass | 203.01 |
| IUPAC Name | sulfonylurea;1,3,5-triazine |
| SMILES | NC(=O)N=S(=O)=O.c1ncncn1 |
| InChI | InChI=1S/C3H3N3.CH2N2O3S/c1-4-2-6-3-5-1;2-1(4)3-7(5)6/h1-3H;(H2,2,4) |
| InChIKey | SQDIJTANRRAMTQ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.18 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze sulfonylurea;1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfonylurea;1,3,5-triazine?
The IUPAC name of sulfonylurea;1,3,5-triazine (CID 19074086) is sulfonylurea;1,3,5-triazine.
What is the SMILES notation for sulfonylurea;1,3,5-triazine?
The canonical SMILES for sulfonylurea;1,3,5-triazine is NC(=O)N=S(=O)=O.c1ncncn1.
What is the InChIKey of sulfonylurea;1,3,5-triazine?
The InChIKey is SQDIJTANRRAMTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3.CH2N2O3S/c1-4-2-6-3-5-1;2-1(4)3-7(5)6/h1-3H;(H2,2,4).
What are the key properties of sulfonylurea;1,3,5-triazine?
sulfonylurea;1,3,5-triazine has a molecular weight of 203.18 g/mol, XLogP of -1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sulfonylurea;1,3,5-triazine is sourced from PubChem (CID 19074086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).