C14H21N3O5S — CID 19075448
3-butoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid (PubChem CID 19075448) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-butoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid.
| Compound Name | 3-butoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid |
|---|---|
| PubChem CID | 19075448 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-butoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid |
| SMILES | CCCCOc1nsnc1C1=CCCN(C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H19N3OS.C2H2O4/c1-3-4-8-16-12-11(13-17-14-12)10-6-5-7-15(2)9-10;3-1(4)2(5)6/h6H,3-5,7-9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | GPXZULCLMCINFE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|