C14H21N3O2S2 — CID 19075484
ethyl 4-[[4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]butanoate (PubChem CID 19075484) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.48 g/mol. Its IUPAC name is ethyl 4-[[4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]butanoate.
| Compound Name | ethyl 4-[[4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 19075484 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | ethyl 4-[[4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]butanoate |
| SMILES | CCOC(=O)CCCSc1nsnc1C1=CCCN(C)C1 |
| InChI | InChI=1S/C14H21N3O2S2/c1-3-19-12(18)7-5-9-20-14-13(15-21-16-14)11-6-4-8-17(2)10-11/h6H,3-5,7-10H2,1-2H3 |
| InChIKey | QSFLDIAOSFPUBX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|