C12H17N3O4S2 — CID 19075505
3-ethylsulfanyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid (PubChem CID 19075505) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-ethylsulfanyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid.
| Compound Name | 3-ethylsulfanyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid |
|---|---|
| PubChem CID | 19075505 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 3-ethylsulfanyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid |
| SMILES | CCSc1nsnc1C1=CCCN(C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H15N3S2.C2H2O4/c1-3-14-10-9(11-15-12-10)8-5-4-6-13(2)7-8;3-1(4)2(5)6/h5H,3-4,6-7H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | MJZGKZOHTZVYON-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|