C20H44O2Si — CID 19076223
diethoxy-(2-methylpropyl)-(2,4,4,6,6-pentamethylheptyl)silane (PubChem CID 19076223) has the molecular formula C20H44O2Si and a molecular weight of 344.66 g/mol. Its IUPAC name is diethoxy-(2-methylpropyl)-(2,4,4,6,6-pentamethylheptyl)silane.
| Compound Name | diethoxy-(2-methylpropyl)-(2,4,4,6,6-pentamethylheptyl)silane |
|---|---|
| PubChem CID | 19076223 |
| Molecular Formula | C20H44O2Si |
| Molecular Weight | 344.66 g/mol |
| Exact Mass | 344.31 |
| IUPAC Name | diethoxy-(2-methylpropyl)-(2,4,4,6,6-pentamethylheptyl)silane |
| SMILES | CCO[Si](CC(C)C)(CC(C)CC(C)(C)CC(C)(C)C)OCC |
| InChI | InChI=1S/C20H44O2Si/c1-11-21-23(22-12-2,14-17(3)4)15-18(5)13-20(9,10)16-19(6,7)8/h17-18H,11-16H2,1-10H3 |
| InChIKey | MDEGISOCLYCLIE-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.66 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|