C18H40O2Si — CID 19076224
butan-2-yl-dimethoxy-(2,4,4,6,6-pentamethylheptyl)silane (PubChem CID 19076224) has the molecular formula C18H40O2Si and a molecular weight of 316.60 g/mol. Its IUPAC name is butan-2-yl-dimethoxy-(2,4,4,6,6-pentamethylheptyl)silane.
| Compound Name | butan-2-yl-dimethoxy-(2,4,4,6,6-pentamethylheptyl)silane |
|---|---|
| PubChem CID | 19076224 |
| Molecular Formula | C18H40O2Si |
| Molecular Weight | 316.60 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | butan-2-yl-dimethoxy-(2,4,4,6,6-pentamethylheptyl)silane |
| SMILES | CCC(C)[Si](CC(C)CC(C)(C)CC(C)(C)C)(OC)OC |
| InChI | InChI=1S/C18H40O2Si/c1-11-16(3)21(19-9,20-10)13-15(2)12-18(7,8)14-17(4,5)6/h15-16H,11-14H2,1-10H3 |
| InChIKey | LBTYQJKGBCDUSU-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|