C19H42O2Si — CID 19076226
diethoxy-(2,4,4,6,6-pentamethylheptyl)-propan-2-ylsilane (PubChem CID 19076226) has the molecular formula C19H42O2Si and a molecular weight of 330.63 g/mol. Its IUPAC name is diethoxy-(2,4,4,6,6-pentamethylheptyl)-propan-2-ylsilane.
| Compound Name | diethoxy-(2,4,4,6,6-pentamethylheptyl)-propan-2-ylsilane |
|---|---|
| PubChem CID | 19076226 |
| Molecular Formula | C19H42O2Si |
| Molecular Weight | 330.63 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | diethoxy-(2,4,4,6,6-pentamethylheptyl)-propan-2-ylsilane |
| SMILES | CCO[Si](CC(C)CC(C)(C)CC(C)(C)C)(OCC)C(C)C |
| InChI | InChI=1S/C19H42O2Si/c1-11-20-22(16(3)4,21-12-2)14-17(5)13-19(9,10)15-18(6,7)8/h16-17H,11-15H2,1-10H3 |
| InChIKey | BOILUHVNXWSWOY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|