About N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride
N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride (PubChem CID 19076265) has the molecular formula C6H6ClN3O3
and a molecular weight of 203.59 g/mol. Its IUPAC name is N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride.
Molecular Properties
| Compound Name | N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride |
| PubChem CID | 19076265 |
| Molecular Formula | C6H6ClN3O3 |
| Molecular Weight | 203.59 g/mol |
| Exact Mass | 203.01 |
| IUPAC Name | N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride |
| SMILES | Cc1cn(NC(=O)Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H6ClN3O3/c1-3-2-10(9-5(7)12)6(13)8-4(3)11/h2H,1H3,(H,9,12)(H,8,11,13) |
| InChIKey | PXSUPCALCDJGKV-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.59 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride?
The IUPAC name of N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride (CID 19076265) is N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride.
What is the SMILES notation for N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride?
The canonical SMILES for N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride is Cc1cn(NC(=O)Cl)c(=O)[nH]c1=O.
What is the InChIKey of N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride?
The InChIKey is PXSUPCALCDJGKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN3O3/c1-3-2-10(9-5(7)12)6(13)8-4(3)11/h2H,1H3,(H,9,12)(H,8,11,13).
What are the key properties of N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride?
N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride has a molecular weight of 203.59 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-2,4-dioxopyrimidin-1-yl)carbamoyl chloride is sourced from PubChem (CID 19076265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).