C32H35Cl3F3N5O6S — CID 19076516
3-[4-[3-(5-aminopentylamino)-5,6-dichloro-3-(2-chlorophenyl)-2-oxoindol-1-yl]sulfonylphenyl]-1,1-diethylurea;2,2,2-trifluoroacetic acid (PubChem CID 19076516) has the molecular formula C32H35Cl3F3N5O6S and a molecular weight of 781.08 g/mol. Its IUPAC name is 3-[4-[3-(5-aminopentylamino)-5,6-dichloro-3-(2-chlorophenyl)-2-oxoindol-1-yl]sulfonylphenyl]-1,1-diethylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-[3-(5-aminopentylamino)-5,6-dichloro-3-(2-chlorophenyl)-2-oxoindol-1-yl]sulfonylphenyl]-1,1-diethylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 19076516 |
| Molecular Formula | C32H35Cl3F3N5O6S |
| Molecular Weight | 781.08 g/mol |
| Exact Mass | 779.13 |
| IUPAC Name | 3-[4-[3-(5-aminopentylamino)-5,6-dichloro-3-(2-chlorophenyl)-2-oxoindol-1-yl]sulfonylphenyl]-1,1-diethylurea;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)C(=O)Nc1ccc(S(=O)(=O)N2C(=O)C(NCCCCCN)(c3ccccc3Cl)c3cc(Cl)c(Cl)cc32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H34Cl3N5O4S.C2HF3O2/c1-3-37(4-2)29(40)36-20-12-14-21(15-13-20)43(41,42)38-27-19-26(33)25(32)18-23(27)30(28(38)39,35-17-9-5-8-16-34)22-10-6-7-11-24(22)31;3-2(4,5)1(6)7/h6-7,10-15,18-19,35H,3-5,8-9,16-17,34H2,1-2H3,(H,36,40);(H,6,7) |
| InChIKey | MKNBTJZOFOBZAX-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.08 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|