About 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one
3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one (PubChem CID 19076543) has the molecular formula C22H19ClN2O5S
and a molecular weight of 458.92 g/mol. Its IUPAC name is 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one.
Molecular Properties
| Compound Name | 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one |
| PubChem CID | 19076543 |
| Molecular Formula | C22H19ClN2O5S |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one |
| SMILES | COc1ccc(S(=O)(=O)N2C(=O)C(N)(c3ccccc3)c3cc(Cl)ccc32)c(OC)c1 |
| InChI | InChI=1S/C22H19ClN2O5S/c1-29-16-9-11-20(19(13-16)30-2)31(27,28)25-18-10-8-15(23)12-17(18)22(24,21(25)26)14-6-4-3-5-7-14/h3-13H,24H2,1-2H3 |
| InChIKey | SHLHWJJKXIDQBJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one?
The IUPAC name of 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one (CID 19076543) is 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one.
What is the SMILES notation for 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one?
The canonical SMILES for 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one is COc1ccc(S(=O)(=O)N2C(=O)C(N)(c3ccccc3)c3cc(Cl)ccc32)c(OC)c1.
What is the InChIKey of 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one?
The InChIKey is SHLHWJJKXIDQBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClN2O5S/c1-29-16-9-11-20(19(13-16)30-2)31(27,28)25-18-10-8-15(23)12-17(18)22(24,21(25)26)14-6-4-3-5-7-14/h3-13H,24H2,1-2H3.
What are the key properties of 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one?
3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one has a molecular weight of 458.92 g/mol, XLogP of 3.30, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-chloro-1-(2,4-dimethoxyphenyl)sulfonyl-3-phenylindol-2-one is sourced from PubChem (CID 19076543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).