About [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate
[3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate (PubChem CID 19076664) has the molecular formula C16H23Cl2NO5S
and a molecular weight of 412.34 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate.
Molecular Properties
| Compound Name | [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate |
| PubChem CID | 19076664 |
| Molecular Formula | C16H23Cl2NO5S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NCC(CCOS(C)(=O)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H23Cl2NO5S/c1-16(2,3)24-15(20)19-10-12(7-8-23-25(4,21)22)11-5-6-13(17)14(18)9-11/h5-6,9,12H,7-8,10H2,1-4H3,(H,19,20) |
| InChIKey | NLZGYJIPYKTMBD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate?
The IUPAC name of [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate (CID 19076664) is [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate.
What is the SMILES notation for [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate?
The canonical SMILES for [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate is CC(C)(C)OC(=O)NCC(CCOS(C)(=O)=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate?
The InChIKey is NLZGYJIPYKTMBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl2NO5S/c1-16(2,3)24-15(20)19-10-12(7-8-23-25(4,21)22)11-5-6-13(17)14(18)9-11/h5-6,9,12H,7-8,10H2,1-4H3,(H,19,20).
What are the key properties of [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate?
[3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate has a molecular weight of 412.34 g/mol, XLogP of 3.97, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,4-dichlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate is sourced from PubChem (CID 19076664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).