C25H21F5N4O3 — CID 19076783
3-[3-[[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]-3-(3,5-difluorophenyl)propanoic acid (PubChem CID 19076783) has the molecular formula C25H21F5N4O3 and a molecular weight of 520.46 g/mol. Its IUPAC name is 3-[3-[[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]-3-(3,5-difluorophenyl)propanoic acid.
| Compound Name | 3-[3-[[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]-3-(3,5-difluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 19076783 |
| Molecular Formula | C25H21F5N4O3 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 3-[3-[[[3-(diaminomethylideneamino)-5-(trifluoromethyl)benzoyl]amino]methyl]phenyl]-3-(3,5-difluorophenyl)propanoic acid |
| SMILES | NC(N)=Nc1cc(C(=O)NCc2cccc(C(CC(=O)O)c3cc(F)cc(F)c3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H21F5N4O3/c26-18-6-15(7-19(27)10-18)21(11-22(35)36)14-3-1-2-13(4-14)12-33-23(37)16-5-17(25(28,29)30)9-20(8-16)34-24(31)32/h1-10,21H,11-12H2,(H,33,37)(H,35,36)(H4,31,32,34) |
| InChIKey | DSWOXDYOQYJGEJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|