About 1-butylsulfanyl-3,7-dimethyloctane
1-butylsulfanyl-3,7-dimethyloctane (PubChem CID 19076955) has the molecular formula C14H30S
and a molecular weight of 230.46 g/mol. Its IUPAC name is 1-butylsulfanyl-3,7-dimethyloctane.
Molecular Properties
| Compound Name | 1-butylsulfanyl-3,7-dimethyloctane |
| PubChem CID | 19076955 |
| Molecular Formula | C14H30S |
| Molecular Weight | 230.46 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 1-butylsulfanyl-3,7-dimethyloctane |
| SMILES | CCCCSCCC(C)CCCC(C)C |
| InChI | InChI=1S/C14H30S/c1-5-6-11-15-12-10-14(4)9-7-8-13(2)3/h13-14H,5-12H2,1-4H3 |
| InChIKey | IOUUQLMCHHUKHR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 230.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butylsulfanyl-3,7-dimethyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfanyl-3,7-dimethyloctane?
The IUPAC name of 1-butylsulfanyl-3,7-dimethyloctane (CID 19076955) is 1-butylsulfanyl-3,7-dimethyloctane.
What is the SMILES notation for 1-butylsulfanyl-3,7-dimethyloctane?
The canonical SMILES for 1-butylsulfanyl-3,7-dimethyloctane is CCCCSCCC(C)CCCC(C)C.
What is the InChIKey of 1-butylsulfanyl-3,7-dimethyloctane?
The InChIKey is IOUUQLMCHHUKHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30S/c1-5-6-11-15-12-10-14(4)9-7-8-13(2)3/h13-14H,5-12H2,1-4H3.
What are the key properties of 1-butylsulfanyl-3,7-dimethyloctane?
1-butylsulfanyl-3,7-dimethyloctane has a molecular weight of 230.46 g/mol, XLogP of 5.37, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfanyl-3,7-dimethyloctane is sourced from PubChem (CID 19076955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).