About 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine
1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine (PubChem CID 19077041) has the molecular formula C19H32N2O4
and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine.
Molecular Properties
| Compound Name | 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine |
| PubChem CID | 19077041 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine |
| SMILES | C1CCC(C(N(CC2CO2)CC2CO2)N(CC2CO2)CC2CO2)CC1 |
| InChI | InChI=1S/C19H32N2O4/c1-2-4-14(5-3-1)19(20(6-15-10-22-15)7-16-11-23-16)21(8-17-12-24-17)9-18-13-25-18/h14-19H,1-13H2 |
| InChIKey | ABVGYNHSINHJFX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 56.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine?
The IUPAC name of 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine (CID 19077041) is 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine.
What is the SMILES notation for 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine?
The canonical SMILES for 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine is C1CCC(C(N(CC2CO2)CC2CO2)N(CC2CO2)CC2CO2)CC1.
What is the InChIKey of 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine?
The InChIKey is ABVGYNHSINHJFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O4/c1-2-4-14(5-3-1)19(20(6-15-10-22-15)7-16-11-23-16)21(8-17-12-24-17)9-18-13-25-18/h14-19H,1-13H2.
What are the key properties of 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine?
1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine has a molecular weight of 352.48 g/mol, XLogP of 1.09, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-N,N,N',N'-tetrakis(oxiran-2-ylmethyl)methanediamine is sourced from PubChem (CID 19077041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).