C30H23F6N3O3 — CID 19077356
4-[7-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9-methyl-6,13-dioxo-8,9,10,11-tetrahydro-[1,4]diazocino[2,1-g][1,7]naphthyridin-5-yl]benzaldehyde (PubChem CID 19077356) has the molecular formula C30H23F6N3O3 and a molecular weight of 587.52 g/mol. Its IUPAC name is 4-[7-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9-methyl-6,13-dioxo-8,9,10,11-tetrahydro-[1,4]diazocino[2,1-g][1,7]naphthyridin-5-yl]benzaldehyde.
| Compound Name | 4-[7-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9-methyl-6,13-dioxo-8,9,10,11-tetrahydro-[1,4]diazocino[2,1-g][1,7]naphthyridin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 19077356 |
| Molecular Formula | C30H23F6N3O3 |
| Molecular Weight | 587.52 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | 4-[7-[[3,5-bis(trifluoromethyl)phenyl]methyl]-9-methyl-6,13-dioxo-8,9,10,11-tetrahydro-[1,4]diazocino[2,1-g][1,7]naphthyridin-5-yl]benzaldehyde |
| SMILES | CC1CCn2c(c(-c3ccc(C=O)cc3)c3cccnc3c2=O)C(=O)N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C30H23F6N3O3/c1-17-8-10-39-26(24(20-6-4-18(16-40)5-7-20)23-3-2-9-37-25(23)27(39)41)28(42)38(14-17)15-19-11-21(29(31,32)33)13-22(12-19)30(34,35)36/h2-7,9,11-13,16-17H,8,10,14-15H2,1H3 |
| InChIKey | DXLAGUNNHFOTCI-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.52 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|