About 2-ethenoxy-5-ethylnonane
2-ethenoxy-5-ethylnonane (PubChem CID 19077760) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is 2-ethenoxy-5-ethylnonane.
Molecular Properties
| Compound Name | 2-ethenoxy-5-ethylnonane |
| PubChem CID | 19077760 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 2-ethenoxy-5-ethylnonane |
| SMILES | C=COC(C)CCC(CC)CCCC |
| InChI | InChI=1S/C13H26O/c1-5-8-9-13(6-2)11-10-12(4)14-7-3/h7,12-13H,3,5-6,8-11H2,1-2,4H3 |
| InChIKey | KCAHZJOADZUUDY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenoxy-5-ethylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenoxy-5-ethylnonane?
The IUPAC name of 2-ethenoxy-5-ethylnonane (CID 19077760) is 2-ethenoxy-5-ethylnonane.
What is the SMILES notation for 2-ethenoxy-5-ethylnonane?
The canonical SMILES for 2-ethenoxy-5-ethylnonane is C=COC(C)CCC(CC)CCCC.
What is the InChIKey of 2-ethenoxy-5-ethylnonane?
The InChIKey is KCAHZJOADZUUDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O/c1-5-8-9-13(6-2)11-10-12(4)14-7-3/h7,12-13H,3,5-6,8-11H2,1-2,4H3.
What are the key properties of 2-ethenoxy-5-ethylnonane?
2-ethenoxy-5-ethylnonane has a molecular weight of 198.35 g/mol, XLogP of 4.53, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenoxy-5-ethylnonane is sourced from PubChem (CID 19077760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).