About cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene
cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene (PubChem CID 19077874) has the molecular formula C23H19Cl2Zr-
and a molecular weight of 457.54 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene |
| PubChem CID | 19077874 |
| Molecular Formula | C23H19Cl2Zr- |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene |
| SMILES | C1=CC(C2C=Cc3ccccc32)c2ccccc21.Cl[Zr]Cl.[C-]1=CC=CC1 |
| InChI | InChI=1S/C18H14.C5H5.2ClH.Zr/c1-3-7-15-13(5-1)9-11-17(15)18-12-10-14-6-2-4-8-16(14)18;1-2-4-5-3-1;;;/h1-12,17-18H;1-3H,4H2;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | ZTZTWBPRCLCLQL-UHFFFAOYSA-L |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene?
The IUPAC name of cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene (CID 19077874) is cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene.
What is the SMILES notation for cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene?
The canonical SMILES for cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene is C1=CC(C2C=Cc3ccccc32)c2ccccc21.Cl[Zr]Cl.[C-]1=CC=CC1.
What is the InChIKey of cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene?
The InChIKey is ZTZTWBPRCLCLQL-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H14.C5H5.2ClH.Zr/c1-3-7-15-13(5-1)9-11-17(15)18-12-10-14-6-2-4-8-16(14)18;1-2-4-5-3-1;;;/h1-12,17-18H;1-3H,4H2;2*1H;/q;-1;;;+2/p-2.
What are the key properties of cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene?
cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene has a molecular weight of 457.54 g/mol, XLogP of 7.29, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;dichlorozirconium;1-(1H-inden-1-yl)-1H-indene is sourced from PubChem (CID 19077874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).